C16H16ClN2O7P — CID 156804061
1-[5-[(6-chloro-2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)oxymethyl]oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 156804061) has the molecular formula C16H16ClN2O7P and a molecular weight of 414.74 g/mol. Its IUPAC name is 1-[5-[(6-chloro-2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)oxymethyl]oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[5-[(6-chloro-2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)oxymethyl]oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 156804061 |
| Molecular Formula | C16H16ClN2O7P |
| Molecular Weight | 414.74 g/mol |
| Exact Mass | 414.04 |
| IUPAC Name | 1-[5-[(6-chloro-2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)oxymethyl]oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | O=c1ccn(C2CCC(COP3(=O)OCc4cc(Cl)ccc4O3)O2)c(=O)[nH]1 |
| InChI | InChI=1S/C16H16ClN2O7P/c17-11-1-3-13-10(7-11)8-23-27(22,26-13)24-9-12-2-4-15(25-12)19-6-5-14(20)18-16(19)21/h1,3,5-7,12,15H,2,4,8-9H2,(H,18,20,21) |
| InChIKey | CKAOVKQALFJUTM-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 108.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.74 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|