C9H13FN3O7P — CID 164882388
[(2R,5R)-2-fluoro-5-[4-(hydroxyamino)-2-oxopyrimidin-1-yl]oxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 164882388) has the molecular formula C9H13FN3O7P and a molecular weight of 325.19 g/mol. Its IUPAC name is [(2R,5R)-2-fluoro-5-[4-(hydroxyamino)-2-oxopyrimidin-1-yl]oxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2R,5R)-2-fluoro-5-[4-(hydroxyamino)-2-oxopyrimidin-1-yl]oxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 164882388 |
| Molecular Formula | C9H13FN3O7P |
| Molecular Weight | 325.19 g/mol |
| Exact Mass | 325.05 |
| IUPAC Name | [(2R,5R)-2-fluoro-5-[4-(hydroxyamino)-2-oxopyrimidin-1-yl]oxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | O=c1nc(NO)ccn1[C@H]1CC[C@@](F)(COP(=O)(O)O)O1 |
| InChI | InChI=1S/C9H13FN3O7P/c10-9(5-19-21(16,17)18)3-1-7(20-9)13-4-2-6(12-15)11-8(13)14/h2,4,7,15H,1,3,5H2,(H,11,12,14)(H2,16,17,18)/t7-,9+/m1/s1 |
| InChIKey | MXCMMFJVPJSCJX-APPZFPTMSA-N |
| XLogP | 0.13 |
| TPSA | 143.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.19 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|