C9H11ClFN3O5 — CID 141473247
1-[(2R,3R,4R,5R)-3-chloro-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-(hydroxyamino)pyrimidin-2-one (PubChem CID 141473247) has the molecular formula C9H11ClFN3O5 and a molecular weight of 295.65 g/mol. Its IUPAC name is 1-[(2R,3R,4R,5R)-3-chloro-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-(hydroxyamino)pyrimidin-2-one.
| Compound Name | 1-[(2R,3R,4R,5R)-3-chloro-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-(hydroxyamino)pyrimidin-2-one |
|---|---|
| PubChem CID | 141473247 |
| Molecular Formula | C9H11ClFN3O5 |
| Molecular Weight | 295.65 g/mol |
| Exact Mass | 295.04 |
| IUPAC Name | 1-[(2R,3R,4R,5R)-3-chloro-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-(hydroxyamino)pyrimidin-2-one |
| SMILES | O=c1nc(NO)ccn1[C@@H]1O[C@H](CO)[C@@H](O)[C@@]1(F)Cl |
| InChI | InChI=1S/C9H11ClFN3O5/c10-9(11)6(16)4(3-15)19-7(9)14-2-1-5(13-18)12-8(14)17/h1-2,4,6-7,15-16,18H,3H2,(H,12,13,17)/t4-,6-,7-,9+/m1/s1 |
| InChIKey | ZFLOYBPJGKHJPA-HCWSKCQFSA-N |
| XLogP | -0.80 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.65 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|