C11H16ClN3O4 — CID 118966291
1-[(2R,3R,4R,5R)-3-chloro-4-hydroxy-5-(hydroxymethyl)-3-methyloxolan-2-yl]-4-(methylamino)pyrimidin-2-one (PubChem CID 118966291) has the molecular formula C11H16ClN3O4 and a molecular weight of 289.72 g/mol. Its IUPAC name is 1-[(2R,3R,4R,5R)-3-chloro-4-hydroxy-5-(hydroxymethyl)-3-methyloxolan-2-yl]-4-(methylamino)pyrimidin-2-one.
| Compound Name | 1-[(2R,3R,4R,5R)-3-chloro-4-hydroxy-5-(hydroxymethyl)-3-methyloxolan-2-yl]-4-(methylamino)pyrimidin-2-one |
|---|---|
| PubChem CID | 118966291 |
| Molecular Formula | C11H16ClN3O4 |
| Molecular Weight | 289.72 g/mol |
| Exact Mass | 289.08 |
| IUPAC Name | 1-[(2R,3R,4R,5R)-3-chloro-4-hydroxy-5-(hydroxymethyl)-3-methyloxolan-2-yl]-4-(methylamino)pyrimidin-2-one |
| SMILES | CNc1ccn([C@@H]2O[C@H](CO)[C@@H](O)[C@@]2(C)Cl)c(=O)n1 |
| InChI | InChI=1S/C11H16ClN3O4/c1-11(12)8(17)6(5-16)19-9(11)15-4-3-7(13-2)14-10(15)18/h3-4,6,8-9,16-17H,5H2,1-2H3,(H,13,14,18)/t6-,8-,9-,11-/m1/s1 |
| InChIKey | XGVIROWEXVWNQS-PNHWDRBUSA-N |
| XLogP | -0.47 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.72 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|