C17H21N3O6 — CID 86729989
1-[(2R,3R,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)-3-methyloxolan-2-yl]-4-(phenylmethoxyamino)pyrimidin-2-one (PubChem CID 86729989) has the molecular formula C17H21N3O6 and a molecular weight of 363.37 g/mol. Its IUPAC name is 1-[(2R,3R,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)-3-methyloxolan-2-yl]-4-(phenylmethoxyamino)pyrimidin-2-one.
| Compound Name | 1-[(2R,3R,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)-3-methyloxolan-2-yl]-4-(phenylmethoxyamino)pyrimidin-2-one |
|---|---|
| PubChem CID | 86729989 |
| Molecular Formula | C17H21N3O6 |
| Molecular Weight | 363.37 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | 1-[(2R,3R,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)-3-methyloxolan-2-yl]-4-(phenylmethoxyamino)pyrimidin-2-one |
| SMILES | C[C@@]1(O)[C@H](O)[C@@H](CO)O[C@H]1n1ccc(NOCc2ccccc2)nc1=O |
| InChI | InChI=1S/C17H21N3O6/c1-17(24)14(22)12(9-21)26-15(17)20-8-7-13(18-16(20)23)19-25-10-11-5-3-2-4-6-11/h2-8,12,14-15,21-22,24H,9-10H2,1H3,(H,18,19,23)/t12-,14-,15-,17-/m1/s1 |
| InChIKey | WNHAVAAXZGXLDP-DNNBLBMLSA-N |
| XLogP | -0.21 |
| TPSA | 126.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.37 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|