C10H13N2O5Se — CID 140732651
CID 140732651 (PubChem CID 140732651) has the molecular formula C10H13N2O5Se and a molecular weight of 320.18 g/mol.
| Compound Name | CID 140732651 |
|---|---|
| PubChem CID | 140732651 |
| Molecular Formula | C10H13N2O5Se |
| Molecular Weight | 320.18 g/mol |
| Exact Mass | 321.00 |
| IUPAC Name | — |
| SMILES | CC1(O)[C@@H](O)[C@@H](CO)O[C@H]1n1ccc(=O)nc1[Se] |
| InChI | InChI=1S/C10H13N2O5Se/c1-10(16)7(15)5(4-13)17-8(10)12-3-2-6(14)11-9(12)18/h2-3,5,7-8,13,15-16H,4H2,1H3/t5-,7+,8-,10?/m1/s1 |
| InChIKey | UCGUNSWYRWSMQP-PELMPBBBSA-N |
| XLogP | -2.96 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.18 |
| LogP ≤ 5 | -2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|