C14H23N3O6 — CID 90137137
4-(butoxyamino)-1-[(2R,3R,5R)-3,4-dihydroxy-5-(hydroxymethyl)-3-methyloxolan-2-yl]pyrimidin-2-one (PubChem CID 90137137) has the molecular formula C14H23N3O6 and a molecular weight of 329.35 g/mol. Its IUPAC name is 4-(butoxyamino)-1-[(2R,3R,5R)-3,4-dihydroxy-5-(hydroxymethyl)-3-methyloxolan-2-yl]pyrimidin-2-one.
| Compound Name | 4-(butoxyamino)-1-[(2R,3R,5R)-3,4-dihydroxy-5-(hydroxymethyl)-3-methyloxolan-2-yl]pyrimidin-2-one |
|---|---|
| PubChem CID | 90137137 |
| Molecular Formula | C14H23N3O6 |
| Molecular Weight | 329.35 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | 4-(butoxyamino)-1-[(2R,3R,5R)-3,4-dihydroxy-5-(hydroxymethyl)-3-methyloxolan-2-yl]pyrimidin-2-one |
| SMILES | CCCCONc1ccn([C@@H]2O[C@H](CO)C(O)[C@@]2(C)O)c(=O)n1 |
| InChI | InChI=1S/C14H23N3O6/c1-3-4-7-22-16-10-5-6-17(13(20)15-10)12-14(2,21)11(19)9(8-18)23-12/h5-6,9,11-12,18-19,21H,3-4,7-8H2,1-2H3,(H,15,16,20)/t9-,11?,12-,14-/m1/s1 |
| InChIKey | LTLIWQOSHASTSH-VXYFJCLZSA-N |
| XLogP | -0.61 |
| TPSA | 126.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.35 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|