C17H20FN3O5 — CID 90117830
1-[(2R,3S,4R,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)-3-methyloxolan-2-yl]-4-(phenylmethoxyamino)pyrimidin-2-one (PubChem CID 90117830) has the molecular formula C17H20FN3O5 and a molecular weight of 365.36 g/mol. Its IUPAC name is 1-[(2R,3S,4R,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)-3-methyloxolan-2-yl]-4-(phenylmethoxyamino)pyrimidin-2-one.
| Compound Name | 1-[(2R,3S,4R,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)-3-methyloxolan-2-yl]-4-(phenylmethoxyamino)pyrimidin-2-one |
|---|---|
| PubChem CID | 90117830 |
| Molecular Formula | C17H20FN3O5 |
| Molecular Weight | 365.36 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | 1-[(2R,3S,4R,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)-3-methyloxolan-2-yl]-4-(phenylmethoxyamino)pyrimidin-2-one |
| SMILES | C[C@]1(F)[C@H](O)[C@@H](CO)O[C@H]1n1ccc(NOCc2ccccc2)nc1=O |
| InChI | InChI=1S/C17H20FN3O5/c1-17(18)14(23)12(9-22)26-15(17)21-8-7-13(19-16(21)24)20-25-10-11-5-3-2-4-6-11/h2-8,12,14-15,22-23H,9-10H2,1H3,(H,19,20,24)/t12-,14-,15-,17+/m1/s1 |
| InChIKey | AERLFNKMTLLBOJ-MMTVNHQJSA-N |
| XLogP | 0.77 |
| TPSA | 105.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.36 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|