C9H10FN2O4Se — CID 176801475
CID 176801475 (PubChem CID 176801475) has the molecular formula C9H10FN2O4Se and a molecular weight of 308.15 g/mol.
| Compound Name | CID 176801475 |
|---|---|
| PubChem CID | 176801475 |
| Molecular Formula | C9H10FN2O4Se |
| Molecular Weight | 308.15 g/mol |
| Exact Mass | 308.98 |
| IUPAC Name | — |
| SMILES | O=c1ccn([C@@H]2O[C@H](CO)C(O)[C@@H]2F)c([Se])n1 |
| InChI | InChI=1S/C9H10FN2O4Se/c10-6-7(15)4(3-13)16-8(6)12-2-1-5(14)11-9(12)17/h1-2,4,6-8,13,15H,3H2/t4-,6+,7?,8-/m1/s1 |
| InChIKey | YCGTZFPAGHZNFS-JDNPWWSISA-N |
| XLogP | -2.37 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.15 |
| LogP ≤ 5 | -2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|