C21H29N4O8P — CID 59367500
4-amino-1-[(2R,3R,4R,5R)-3,4-dihydroxy-3-methyl-5-[[[[(2S)-3-oxobutan-2-yl]amino]-phenylmethoxyphosphoryl]oxymethyl]oxolan-2-yl]pyrimidin-2-one (PubChem CID 59367500) has the molecular formula C21H29N4O8P and a molecular weight of 496.46 g/mol. Its IUPAC name is 4-amino-1-[(2R,3R,4R,5R)-3,4-dihydroxy-3-methyl-5-[[[[(2S)-3-oxobutan-2-yl]amino]-phenylmethoxyphosphoryl]oxymethyl]oxolan-2-yl]pyrimidin-2-one.
| Compound Name | 4-amino-1-[(2R,3R,4R,5R)-3,4-dihydroxy-3-methyl-5-[[[[(2S)-3-oxobutan-2-yl]amino]-phenylmethoxyphosphoryl]oxymethyl]oxolan-2-yl]pyrimidin-2-one |
|---|---|
| PubChem CID | 59367500 |
| Molecular Formula | C21H29N4O8P |
| Molecular Weight | 496.46 g/mol |
| Exact Mass | 496.17 |
| IUPAC Name | 4-amino-1-[(2R,3R,4R,5R)-3,4-dihydroxy-3-methyl-5-[[[[(2S)-3-oxobutan-2-yl]amino]-phenylmethoxyphosphoryl]oxymethyl]oxolan-2-yl]pyrimidin-2-one |
| SMILES | CC(=O)[C@H](C)NP(=O)(OCc1ccccc1)OC[C@H]1O[C@@H](n2ccc(N)nc2=O)[C@](C)(O)[C@@H]1O |
| InChI | InChI=1S/C21H29N4O8P/c1-13(14(2)26)24-34(30,31-11-15-7-5-4-6-8-15)32-12-16-18(27)21(3,29)19(33-16)25-10-9-17(22)23-20(25)28/h4-10,13,16,18-19,27,29H,11-12H2,1-3H3,(H,24,30)(H2,22,23,28)/t13-,16+,18+,19+,21+,34?/m0/s1 |
| InChIKey | KBJTUUUEYIRSCZ-XAEDPNTOSA-N |
| XLogP | 0.74 |
| TPSA | 175.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.46 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|