C27H41N4O9P — CID 24990550
[(2R,3S)-2-[[[(2R,3R,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]-3-methylpentyl] 2,2-dimethylpropanoate (PubChem CID 24990550) has the molecular formula C27H41N4O9P and a molecular weight of 596.62 g/mol. Its IUPAC name is [(2R,3S)-2-[[[(2R,3R,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]-3-methylpentyl] 2,2-dimethylpropanoate.
| Compound Name | [(2R,3S)-2-[[[(2R,3R,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]-3-methylpentyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 24990550 |
| Molecular Formula | C27H41N4O9P |
| Molecular Weight | 596.62 g/mol |
| Exact Mass | 596.26 |
| IUPAC Name | [(2R,3S)-2-[[[(2R,3R,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]-3-methylpentyl] 2,2-dimethylpropanoate |
| SMILES | CC[C@H](C)[C@H](COC(=O)C(C)(C)C)NP(=O)(OC[C@H]1O[C@@H](n2ccc(N)nc2=O)[C@](C)(O)[C@@H]1O)Oc1ccccc1 |
| InChI | InChI=1S/C27H41N4O9P/c1-7-17(2)19(15-37-24(33)26(3,4)5)30-41(36,40-18-11-9-8-10-12-18)38-16-20-22(32)27(6,35)23(39-20)31-14-13-21(28)29-25(31)34/h8-14,17,19-20,22-23,32,35H,7,15-16H2,1-6H3,(H,30,36)(H2,28,29,34)/t17-,19-,20+,22+,23+,27+,41?/m0/s1 |
| InChIKey | CYDMOTSLXRZHDE-RGCGPTMSSA-N |
| XLogP | 2.63 |
| TPSA | 184.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.62 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|