C23H33N4O9P — CID 68669474
2-[[[(2R,3R,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propyl butanoate (PubChem CID 68669474) has the molecular formula C23H33N4O9P and a molecular weight of 540.51 g/mol. Its IUPAC name is 2-[[[(2R,3R,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propyl butanoate.
| Compound Name | 2-[[[(2R,3R,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propyl butanoate |
|---|---|
| PubChem CID | 68669474 |
| Molecular Formula | C23H33N4O9P |
| Molecular Weight | 540.51 g/mol |
| Exact Mass | 540.20 |
| IUPAC Name | 2-[[[(2R,3R,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propyl butanoate |
| SMILES | CCCC(=O)OCC(C)NP(=O)(OC[C@H]1O[C@@H](n2ccc(N)nc2=O)[C@](C)(O)[C@@H]1O)Oc1ccccc1 |
| InChI | InChI=1S/C23H33N4O9P/c1-4-8-19(28)33-13-15(2)26-37(32,36-16-9-6-5-7-10-16)34-14-17-20(29)23(3,31)21(35-17)27-12-11-18(24)25-22(27)30/h5-7,9-12,15,17,20-21,29,31H,4,8,13-14H2,1-3H3,(H,26,32)(H2,24,25,30)/t15?,17-,20-,21-,23-,37?/m1/s1 |
| InChIKey | HOYTTXWUSBFWHT-KQGOSEDGSA-N |
| XLogP | 1.36 |
| TPSA | 184.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.51 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|