C25H36ClN4O9P — CID 70799175
ethyl (2S)-2-[[[(2R,3R,4R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-(4-chloro-5-methyl-2-propan-2-ylphenoxy)phosphoryl]amino]propanoate (PubChem CID 70799175) has the molecular formula C25H36ClN4O9P and a molecular weight of 603.01 g/mol. Its IUPAC name is ethyl (2S)-2-[[[(2R,3R,4R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-(4-chloro-5-methyl-2-propan-2-ylphenoxy)phosphoryl]amino]propanoate.
| Compound Name | ethyl (2S)-2-[[[(2R,3R,4R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-(4-chloro-5-methyl-2-propan-2-ylphenoxy)phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 70799175 |
| Molecular Formula | C25H36ClN4O9P |
| Molecular Weight | 603.01 g/mol |
| Exact Mass | 602.19 |
| IUPAC Name | ethyl (2S)-2-[[[(2R,3R,4R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-(4-chloro-5-methyl-2-propan-2-ylphenoxy)phosphoryl]amino]propanoate |
| SMILES | CCOC(=O)[C@H](C)NP(=O)(OC[C@H]1OC(n2ccc(N)nc2=O)[C@](C)(O)[C@@H]1O)Oc1cc(C)c(Cl)cc1C(C)C |
| InChI | InChI=1S/C25H36ClN4O9P/c1-7-36-22(32)15(5)29-40(35,39-18-10-14(4)17(26)11-16(18)13(2)3)37-12-19-21(31)25(6,34)23(38-19)30-9-8-20(27)28-24(30)33/h8-11,13,15,19,21,23,31,34H,7,12H2,1-6H3,(H,29,35)(H2,27,28,33)/t15-,19+,21+,23?,25+,40?/m0/s1 |
| InChIKey | VAVBOHIIWLYABS-AGDPAWLSSA-N |
| XLogP | 2.66 |
| TPSA | 184.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.01 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|