C22H29ClN7O8P — CID 66562426
propan-2-yl (2S)-2-[[[(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4-azido-3-hydroxy-4-methyloxolan-2-yl]methoxy-(2-chlorophenoxy)phosphoryl]amino]propanoate (PubChem CID 66562426) has the molecular formula C22H29ClN7O8P and a molecular weight of 585.94 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[[(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4-azido-3-hydroxy-4-methyloxolan-2-yl]methoxy-(2-chlorophenoxy)phosphoryl]amino]propanoate.
| Compound Name | propan-2-yl (2S)-2-[[[(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4-azido-3-hydroxy-4-methyloxolan-2-yl]methoxy-(2-chlorophenoxy)phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 66562426 |
| Molecular Formula | C22H29ClN7O8P |
| Molecular Weight | 585.94 g/mol |
| Exact Mass | 585.15 |
| IUPAC Name | propan-2-yl (2S)-2-[[[(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4-azido-3-hydroxy-4-methyloxolan-2-yl]methoxy-(2-chlorophenoxy)phosphoryl]amino]propanoate |
| SMILES | CC(C)OC(=O)[C@H](C)NP(=O)(OC[C@H]1O[C@@H](n2ccc(N)nc2=O)[C@](C)(N=[N+]=[N-])[C@@H]1O)Oc1ccccc1Cl |
| InChI | InChI=1S/C22H29ClN7O8P/c1-12(2)36-19(32)13(3)27-39(34,38-15-8-6-5-7-14(15)23)35-11-16-18(31)22(4,28-29-25)20(37-16)30-10-9-17(24)26-21(30)33/h5-10,12-13,16,18,20,31H,11H2,1-4H3,(H,27,34)(H2,24,26,33)/t13-,16+,18+,20+,22+,39?/m0/s1 |
| InChIKey | FXKOXVDJGBOPQZ-AYUAHIRNSA-N |
| XLogP | 2.94 |
| TPSA | 212.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.94 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|