C27H40ClN4O9P — CID 16722224
butyl (2S)-2-[[[(2R,3R,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-(4-chloro-5-methyl-2-propan-2-ylphenoxy)phosphoryl]amino]propanoate (PubChem CID 16722224) has the molecular formula C27H40ClN4O9P and a molecular weight of 631.06 g/mol. Its IUPAC name is butyl (2S)-2-[[[(2R,3R,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-(4-chloro-5-methyl-2-propan-2-ylphenoxy)phosphoryl]amino]propanoate.
| Compound Name | butyl (2S)-2-[[[(2R,3R,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-(4-chloro-5-methyl-2-propan-2-ylphenoxy)phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 16722224 |
| Molecular Formula | C27H40ClN4O9P |
| Molecular Weight | 631.06 g/mol |
| Exact Mass | 630.22 |
| IUPAC Name | butyl (2S)-2-[[[(2R,3R,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-(4-chloro-5-methyl-2-propan-2-ylphenoxy)phosphoryl]amino]propanoate |
| SMILES | CCCCOC(=O)[C@H](C)NP(=O)(OC[C@H]1O[C@@H](n2ccc(N)nc2=O)[C@](C)(O)[C@@H]1O)Oc1cc(C)c(Cl)cc1C(C)C |
| InChI | InChI=1S/C27H40ClN4O9P/c1-7-8-11-38-24(34)17(5)31-42(37,41-20-12-16(4)19(28)13-18(20)15(2)3)39-14-21-23(33)27(6,36)25(40-21)32-10-9-22(29)30-26(32)35/h9-10,12-13,15,17,21,23,25,33,36H,7-8,11,14H2,1-6H3,(H,31,37)(H2,29,30,35)/t17-,21+,23+,25+,27+,42?/m0/s1 |
| InChIKey | CTELYCABGXFWMR-WOHGMPHTSA-N |
| XLogP | 3.45 |
| TPSA | 184.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.06 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|