C25H26ClN4O9P — CID 71542964
methyl (2S)-2-[[[(2R,3R,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4-(2-chloroethynyl)-3,4-dihydroxyoxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate (PubChem CID 71542964) has the molecular formula C25H26ClN4O9P and a molecular weight of 592.93 g/mol. Its IUPAC name is methyl (2S)-2-[[[(2R,3R,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4-(2-chloroethynyl)-3,4-dihydroxyoxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate.
| Compound Name | methyl (2S)-2-[[[(2R,3R,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4-(2-chloroethynyl)-3,4-dihydroxyoxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 71542964 |
| Molecular Formula | C25H26ClN4O9P |
| Molecular Weight | 592.93 g/mol |
| Exact Mass | 592.11 |
| IUPAC Name | methyl (2S)-2-[[[(2R,3R,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4-(2-chloroethynyl)-3,4-dihydroxyoxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate |
| SMILES | COC(=O)[C@H](C)NP(=O)(OC[C@H]1O[C@@H](n2ccc(N)nc2=O)[C@@](O)(C#CCl)[C@@H]1O)Oc1cccc2ccccc12 |
| InChI | InChI=1S/C25H26ClN4O9P/c1-15(22(32)36-2)29-40(35,39-18-9-5-7-16-6-3-4-8-17(16)18)37-14-19-21(31)25(34,11-12-26)23(38-19)30-13-10-20(27)28-24(30)33/h3-10,13,15,19,21,23,31,34H,14H2,1-2H3,(H,29,35)(H2,27,28,33)/t15-,19+,21+,23+,25+,40?/m0/s1 |
| InChIKey | CRCJOSIYIWAUTE-WQZFGADUSA-N |
| XLogP | 1.52 |
| TPSA | 184.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.93 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|