C14H26N3O12P3 — CID 163556647
[[(2S)-5-(4-amino-2-oxopyrimidin-1-yl)-2-(3-methylbutyl)oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 163556647) has the molecular formula C14H26N3O12P3 and a molecular weight of 521.29 g/mol. Its IUPAC name is [[(2S)-5-(4-amino-2-oxopyrimidin-1-yl)-2-(3-methylbutyl)oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2S)-5-(4-amino-2-oxopyrimidin-1-yl)-2-(3-methylbutyl)oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 163556647 |
| Molecular Formula | C14H26N3O12P3 |
| Molecular Weight | 521.29 g/mol |
| Exact Mass | 521.07 |
| IUPAC Name | [[(2S)-5-(4-amino-2-oxopyrimidin-1-yl)-2-(3-methylbutyl)oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | CC(C)CC[C@@]1(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)CCC(n2ccc(N)nc2=O)O1 |
| InChI | InChI=1S/C14H26N3O12P3/c1-10(2)3-6-14(7-4-12(27-14)17-8-5-11(15)16-13(17)18)9-26-31(22,23)29-32(24,25)28-30(19,20)21/h5,8,10,12H,3-4,6-7,9H2,1-2H3,(H,22,23)(H,24,25)(H2,15,16,18)(H2,19,20,21)/t12?,14-/m0/s1 |
| InChIKey | FNQCQPYDLTXLEP-PYMCNQPYSA-N |
| XLogP | 1.65 |
| TPSA | 229.96 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.29 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|