C12H22ClN3O4 — CID 169252416
chloromethane;ethane;4-(hydroxyamino)-1-[5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one (PubChem CID 169252416) has the molecular formula C12H22ClN3O4 and a molecular weight of 307.78 g/mol. Its IUPAC name is chloromethane;ethane;4-(hydroxyamino)-1-[5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one.
| Compound Name | chloromethane;ethane;4-(hydroxyamino)-1-[5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one |
|---|---|
| PubChem CID | 169252416 |
| Molecular Formula | C12H22ClN3O4 |
| Molecular Weight | 307.78 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | chloromethane;ethane;4-(hydroxyamino)-1-[5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one |
| SMILES | CC.CCl.O=c1nc(NO)ccn1C1CCC(CO)O1 |
| InChI | InChI=1S/C9H13N3O4.C2H6.CH3Cl/c13-5-6-1-2-8(16-6)12-4-3-7(11-15)10-9(12)14;2*1-2/h3-4,6,8,13,15H,1-2,5H2,(H,10,11,14);1-2H3;1H3 |
| InChIKey | DYTGYVKRDQWORA-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.78 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|