C20H30N4O6 — CID 178171551
ethane;1-[(2R)-5-(hydroxymethyl)oxolan-2-yl]-4-[1-(2-nitrophenyl)ethylamino]pyrimidin-2-one;methanol (PubChem CID 178171551) has the molecular formula C20H30N4O6 and a molecular weight of 422.48 g/mol. Its IUPAC name is ethane;1-[(2R)-5-(hydroxymethyl)oxolan-2-yl]-4-[1-(2-nitrophenyl)ethylamino]pyrimidin-2-one;methanol.
| Compound Name | ethane;1-[(2R)-5-(hydroxymethyl)oxolan-2-yl]-4-[1-(2-nitrophenyl)ethylamino]pyrimidin-2-one;methanol |
|---|---|
| PubChem CID | 178171551 |
| Molecular Formula | C20H30N4O6 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | ethane;1-[(2R)-5-(hydroxymethyl)oxolan-2-yl]-4-[1-(2-nitrophenyl)ethylamino]pyrimidin-2-one;methanol |
| SMILES | CC.CC(Nc1ccn([C@H]2CCC(CO)O2)c(=O)n1)c1ccccc1[N+](=O)[O-].CO |
| InChI | InChI=1S/C17H20N4O5.C2H6.CH4O/c1-11(13-4-2-3-5-14(13)21(24)25)18-15-8-9-20(17(23)19-15)16-7-6-12(10-22)26-16;2*1-2/h2-5,8-9,11-12,16,22H,6-7,10H2,1H3,(H,18,19,23);1-2H3;2H,1H3/t11?,12?,16-;;/m1../s1 |
| InChIKey | QWTJVKAZGSRWFP-HVBHEUCJSA-N |
| XLogP | 2.63 |
| TPSA | 139.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|