C18H22N4O5 — CID 178171555
1-[(2R,5S)-5-(methoxymethyl)oxolan-2-yl]-4-[1-(2-nitrophenyl)ethylamino]pyrimidin-2-one (PubChem CID 178171555) has the molecular formula C18H22N4O5 and a molecular weight of 374.40 g/mol. Its IUPAC name is 1-[(2R,5S)-5-(methoxymethyl)oxolan-2-yl]-4-[1-(2-nitrophenyl)ethylamino]pyrimidin-2-one.
| Compound Name | 1-[(2R,5S)-5-(methoxymethyl)oxolan-2-yl]-4-[1-(2-nitrophenyl)ethylamino]pyrimidin-2-one |
|---|---|
| PubChem CID | 178171555 |
| Molecular Formula | C18H22N4O5 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | 1-[(2R,5S)-5-(methoxymethyl)oxolan-2-yl]-4-[1-(2-nitrophenyl)ethylamino]pyrimidin-2-one |
| SMILES | COC[C@@H]1CC[C@H](n2ccc(NC(C)c3ccccc3[N+](=O)[O-])nc2=O)O1 |
| InChI | InChI=1S/C18H22N4O5/c1-12(14-5-3-4-6-15(14)22(24)25)19-16-9-10-21(18(23)20-16)17-8-7-13(27-17)11-26-2/h3-6,9-10,12-13,17H,7-8,11H2,1-2H3,(H,19,20,23)/t12?,13-,17+/m0/s1 |
| InChIKey | MHTXGZFAOJQPEN-PMBLOPFUSA-N |
| XLogP | 2.65 |
| TPSA | 108.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|