C16H18N4O4Se — CID 88611297
4-amino-5-methyl-1-[(2R,5S)-5-[(2-nitrophenyl)selanylmethyl]oxolan-2-yl]pyrimidin-2-one (PubChem CID 88611297) has the molecular formula C16H18N4O4Se and a molecular weight of 409.30 g/mol. Its IUPAC name is 4-amino-5-methyl-1-[(2R,5S)-5-[(2-nitrophenyl)selanylmethyl]oxolan-2-yl]pyrimidin-2-one.
| Compound Name | 4-amino-5-methyl-1-[(2R,5S)-5-[(2-nitrophenyl)selanylmethyl]oxolan-2-yl]pyrimidin-2-one |
|---|---|
| PubChem CID | 88611297 |
| Molecular Formula | C16H18N4O4Se |
| Molecular Weight | 409.30 g/mol |
| Exact Mass | 410.05 |
| IUPAC Name | 4-amino-5-methyl-1-[(2R,5S)-5-[(2-nitrophenyl)selanylmethyl]oxolan-2-yl]pyrimidin-2-one |
| SMILES | Cc1cn([C@H]2CC[C@@H](C[Se]c3ccccc3[N+](=O)[O-])O2)c(=O)nc1N |
| InChI | InChI=1S/C16H18N4O4Se/c1-10-8-19(16(21)18-15(10)17)14-7-6-11(24-14)9-25-13-5-3-2-4-12(13)20(22)23/h2-5,8,11,14H,6-7,9H2,1H3,(H2,17,18,21)/t11-,14+/m0/s1 |
| InChIKey | PJMJNJBBGVVMEX-SMDDNHRTSA-N |
| XLogP | 1.17 |
| TPSA | 113.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.30 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|