C15H15N3O5Se — CID 88611292
1-[(2S,5S)-5-methyloxolan-2-yl]-5-(2-nitrophenyl)selanylpyrimidine-2,4-dione (PubChem CID 88611292) has the molecular formula C15H15N3O5Se and a molecular weight of 396.26 g/mol. Its IUPAC name is 1-[(2S,5S)-5-methyloxolan-2-yl]-5-(2-nitrophenyl)selanylpyrimidine-2,4-dione.
| Compound Name | 1-[(2S,5S)-5-methyloxolan-2-yl]-5-(2-nitrophenyl)selanylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 88611292 |
| Molecular Formula | C15H15N3O5Se |
| Molecular Weight | 396.26 g/mol |
| Exact Mass | 397.02 |
| IUPAC Name | 1-[(2S,5S)-5-methyloxolan-2-yl]-5-(2-nitrophenyl)selanylpyrimidine-2,4-dione |
| SMILES | C[C@H]1CC[C@@H](n2cc([Se]c3ccccc3[N+](=O)[O-])c(=O)[nH]c2=O)O1 |
| InChI | InChI=1S/C15H15N3O5Se/c1-9-6-7-13(23-9)17-8-12(14(19)16-15(17)20)24-11-5-3-2-4-10(11)18(21)22/h2-5,8-9,13H,6-7H2,1H3,(H,16,19,20)/t9-,13-/m0/s1 |
| InChIKey | QLQJKWFWMJVRSK-ZANVPECISA-N |
| XLogP | -0.20 |
| TPSA | 107.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.26 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|