C9H11IN2O3 — CID 68663052
5-iodo-1-(5-methyloxolan-2-yl)pyrimidine-2,4-dione (PubChem CID 68663052) has the molecular formula C9H11IN2O3 and a molecular weight of 322.10 g/mol. Its IUPAC name is 5-iodo-1-(5-methyloxolan-2-yl)pyrimidine-2,4-dione.
| Compound Name | 5-iodo-1-(5-methyloxolan-2-yl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 68663052 |
| Molecular Formula | C9H11IN2O3 |
| Molecular Weight | 322.10 g/mol |
| Exact Mass | 321.98 |
| IUPAC Name | 5-iodo-1-(5-methyloxolan-2-yl)pyrimidine-2,4-dione |
| SMILES | CC1CCC(n2cc(I)c(=O)[nH]c2=O)O1 |
| InChI | InChI=1S/C9H11IN2O3/c1-5-2-3-7(15-5)12-4-6(10)8(13)11-9(12)14/h4-5,7H,2-3H2,1H3,(H,11,13,14) |
| InChIKey | NNDUXVHXAZGIOY-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.10 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|