C19H23N3O9S — CID 15382495
[(2R,3S,5R)-2-(hydroxymethyl)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] 2-(2-nitrophenyl)propane-1-sulfonate (PubChem CID 15382495) has the molecular formula C19H23N3O9S and a molecular weight of 469.47 g/mol. Its IUPAC name is [(2R,3S,5R)-2-(hydroxymethyl)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] 2-(2-nitrophenyl)propane-1-sulfonate.
| Compound Name | [(2R,3S,5R)-2-(hydroxymethyl)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] 2-(2-nitrophenyl)propane-1-sulfonate |
|---|---|
| PubChem CID | 15382495 |
| Molecular Formula | C19H23N3O9S |
| Molecular Weight | 469.47 g/mol |
| Exact Mass | 469.12 |
| IUPAC Name | [(2R,3S,5R)-2-(hydroxymethyl)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] 2-(2-nitrophenyl)propane-1-sulfonate |
| SMILES | Cc1cn([C@H]2C[C@H](OS(=O)(=O)CC(C)c3ccccc3[N+](=O)[O-])[C@@H](CO)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C19H23N3O9S/c1-11-8-21(19(25)20-18(11)24)17-7-15(16(9-23)30-17)31-32(28,29)10-12(2)13-5-3-4-6-14(13)22(26)27/h3-6,8,12,15-17,23H,7,9-10H2,1-2H3,(H,20,24,25)/t12?,15-,16+,17+/m0/s1 |
| InChIKey | VSEIOOOSVBOXSY-GUPZPADCSA-N |
| XLogP | 0.55 |
| TPSA | 170.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.47 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|