C10H13N3O6 — CID 10445914
1-[(2R,4S,5S)-4-deuterio-5-(hydroxymethyl)-4-nitrooxolan-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 10445914) has the molecular formula C10H13N3O6 and a molecular weight of 272.24 g/mol. Its IUPAC name is 1-[(2R,4S,5S)-4-deuterio-5-(hydroxymethyl)-4-nitrooxolan-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(2R,4S,5S)-4-deuterio-5-(hydroxymethyl)-4-nitrooxolan-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 10445914 |
| Molecular Formula | C10H13N3O6 |
| Molecular Weight | 272.24 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | 1-[(2R,4S,5S)-4-deuterio-5-(hydroxymethyl)-4-nitrooxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | [2H][C@]1([N+](=O)[O-])C[C@H](n2cc(C)c(=O)[nH]c2=O)O[C@@H]1CO |
| InChI | InChI=1S/C10H13N3O6/c1-5-3-12(10(16)11-9(5)15)8-2-6(13(17)18)7(4-14)19-8/h3,6-8,14H,2,4H2,1H3,(H,11,15,16)/t6-,7+,8+/m0/s1/i6D |
| InChIKey | STLCSWMENRFYNO-CKHMMZHJSA-N |
| XLogP | -1.23 |
| TPSA | 127.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.24 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|