C10H14N2O7P+ — CID 102099322
hydroxy-[(2R,3S,5R)-2-(hydroxymethyl)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]oxy-oxophosphanium (PubChem CID 102099322) has the molecular formula C10H14N2O7P+ and a molecular weight of 305.20 g/mol. Its IUPAC name is hydroxy-[(2R,3S,5R)-2-(hydroxymethyl)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]oxy-oxophosphanium.
| Compound Name | hydroxy-[(2R,3S,5R)-2-(hydroxymethyl)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]oxy-oxophosphanium |
|---|---|
| PubChem CID | 102099322 |
| Molecular Formula | C10H14N2O7P+ |
| Molecular Weight | 305.20 g/mol |
| Exact Mass | 305.05 |
| IUPAC Name | hydroxy-[(2R,3S,5R)-2-(hydroxymethyl)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]oxy-oxophosphanium |
| SMILES | Cc1cn([C@H]2C[C@H](O[P+](=O)O)[C@@H](CO)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C10H13N2O7P/c1-5-3-12(10(15)11-9(5)14)8-2-6(19-20(16)17)7(4-13)18-8/h3,6-8,13H,2,4H2,1H3,(H-,11,14,15,16,17)/p+1/t6-,7+,8+/m0/s1 |
| InChIKey | WMWRQFGAOROZFM-XLPZGREQSA-O |
| XLogP | -0.84 |
| TPSA | 130.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.20 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|