C21H28N3O10P — CID 58104968
[(2R,5R)-2-(methoxymethyl)-5-[5-methyl-4-[2-(2-nitrophenyl)propoxy]-2-oxopyrimidin-1-yl]oxolan-3-yl] methyl hydrogen phosphate (PubChem CID 58104968) has the molecular formula C21H28N3O10P and a molecular weight of 513.44 g/mol. Its IUPAC name is [(2R,5R)-2-(methoxymethyl)-5-[5-methyl-4-[2-(2-nitrophenyl)propoxy]-2-oxopyrimidin-1-yl]oxolan-3-yl] methyl hydrogen phosphate.
| Compound Name | [(2R,5R)-2-(methoxymethyl)-5-[5-methyl-4-[2-(2-nitrophenyl)propoxy]-2-oxopyrimidin-1-yl]oxolan-3-yl] methyl hydrogen phosphate |
|---|---|
| PubChem CID | 58104968 |
| Molecular Formula | C21H28N3O10P |
| Molecular Weight | 513.44 g/mol |
| Exact Mass | 513.15 |
| IUPAC Name | [(2R,5R)-2-(methoxymethyl)-5-[5-methyl-4-[2-(2-nitrophenyl)propoxy]-2-oxopyrimidin-1-yl]oxolan-3-yl] methyl hydrogen phosphate |
| SMILES | COC[C@H]1O[C@@H](n2cc(C)c(OCC(C)c3ccccc3[N+](=O)[O-])nc2=O)CC1OP(=O)(O)OC |
| InChI | InChI=1S/C21H28N3O10P/c1-13-10-23(19-9-17(18(33-19)12-30-3)34-35(28,29)31-4)21(25)22-20(13)32-11-14(2)15-7-5-6-8-16(15)24(26)27/h5-8,10,14,17-19H,9,11-12H2,1-4H3,(H,28,29)/t14?,17?,18-,19-/m1/s1 |
| InChIKey | NMDYWYPHANZRJH-UNLQRWGISA-N |
| XLogP | 2.71 |
| TPSA | 161.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.44 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|