C20H34N2O8P- — CID 102341623
1-[(2R,4S,5R)-4-[decoxy(hydroxy)phosphoryl]oxy-5-(hydroxymethyl)oxolan-2-yl]-5-methyl-2-oxopyrimidin-4-olate (PubChem CID 102341623) has the molecular formula C20H34N2O8P- and a molecular weight of 461.47 g/mol. Its IUPAC name is 1-[(2R,4S,5R)-4-[decoxy(hydroxy)phosphoryl]oxy-5-(hydroxymethyl)oxolan-2-yl]-5-methyl-2-oxopyrimidin-4-olate.
| Compound Name | 1-[(2R,4S,5R)-4-[decoxy(hydroxy)phosphoryl]oxy-5-(hydroxymethyl)oxolan-2-yl]-5-methyl-2-oxopyrimidin-4-olate |
|---|---|
| PubChem CID | 102341623 |
| Molecular Formula | C20H34N2O8P- |
| Molecular Weight | 461.47 g/mol |
| Exact Mass | 461.21 |
| IUPAC Name | 1-[(2R,4S,5R)-4-[decoxy(hydroxy)phosphoryl]oxy-5-(hydroxymethyl)oxolan-2-yl]-5-methyl-2-oxopyrimidin-4-olate |
| SMILES | CCCCCCCCCCOP(=O)(O)O[C@H]1C[C@H](n2cc(C)c([O-])nc2=O)O[C@@H]1CO |
| InChI | InChI=1S/C20H35N2O8P/c1-3-4-5-6-7-8-9-10-11-28-31(26,27)30-16-12-18(29-17(16)14-23)22-13-15(2)19(24)21-20(22)25/h13,16-18,23H,3-12,14H2,1-2H3,(H,26,27)(H,21,24,25)/p-1/t16-,17+,18+/m0/s1 |
| InChIKey | PNDRGHOAHYOCPH-RCCFBDPRSA-M |
| XLogP | 2.55 |
| TPSA | 143.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.47 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|