C18H31N2O8P — CID 102192256
[(2R,3S,5R)-2-(hydroxymethyl)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] octyl hydrogen phosphate (PubChem CID 102192256) has the molecular formula C18H31N2O8P and a molecular weight of 434.43 g/mol. Its IUPAC name is [(2R,3S,5R)-2-(hydroxymethyl)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] octyl hydrogen phosphate.
| Compound Name | [(2R,3S,5R)-2-(hydroxymethyl)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] octyl hydrogen phosphate |
|---|---|
| PubChem CID | 102192256 |
| Molecular Formula | C18H31N2O8P |
| Molecular Weight | 434.43 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | [(2R,3S,5R)-2-(hydroxymethyl)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] octyl hydrogen phosphate |
| SMILES | CCCCCCCCOP(=O)(O)O[C@H]1C[C@H](n2cc(C)c(=O)[nH]c2=O)O[C@@H]1CO |
| InChI | InChI=1S/C18H31N2O8P/c1-3-4-5-6-7-8-9-26-29(24,25)28-14-10-16(27-15(14)12-21)20-11-13(2)17(22)19-18(20)23/h11,14-16,21H,3-10,12H2,1-2H3,(H,24,25)(H,19,22,23)/t14-,15+,16+/m0/s1 |
| InChIKey | QDPPENWZVMTVAE-ARFHVFGLSA-N |
| XLogP | 1.99 |
| TPSA | 140.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.43 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|