C12H19N3O7P- — CID 153458803
[(2R,3R,5R)-5-(4-amino-5-methyl-2-oxopyrimidin-1-yl)-2-(methoxymethyl)oxolan-3-yl] methyl phosphate (PubChem CID 153458803) has the molecular formula C12H19N3O7P- and a molecular weight of 348.27 g/mol. Its IUPAC name is [(2R,3R,5R)-5-(4-amino-5-methyl-2-oxopyrimidin-1-yl)-2-(methoxymethyl)oxolan-3-yl] methyl phosphate.
| Compound Name | [(2R,3R,5R)-5-(4-amino-5-methyl-2-oxopyrimidin-1-yl)-2-(methoxymethyl)oxolan-3-yl] methyl phosphate |
|---|---|
| PubChem CID | 153458803 |
| Molecular Formula | C12H19N3O7P- |
| Molecular Weight | 348.27 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | [(2R,3R,5R)-5-(4-amino-5-methyl-2-oxopyrimidin-1-yl)-2-(methoxymethyl)oxolan-3-yl] methyl phosphate |
| SMILES | COC[C@H]1O[C@@H](n2cc(C)c(N)nc2=O)C[C@H]1OP(=O)([O-])OC |
| InChI | InChI=1S/C12H20N3O7P/c1-7-5-15(12(16)14-11(7)13)10-4-8(9(21-10)6-19-2)22-23(17,18)20-3/h5,8-10H,4,6H2,1-3H3,(H,17,18)(H2,13,14,16)/p-1/t8-,9-,10-/m1/s1 |
| InChIKey | LANDFPCXBQISDS-OPRDCNLKSA-M |
| XLogP | -0.43 |
| TPSA | 137.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.27 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|