C39H44N3O6PSi — CID 11767721
4-amino-1-[(2R,4S,5R)-4-[tert-butyl(diphenyl)silyl]oxy-5-(diphenylphosphoryloxymethoxymethyl)oxolan-2-yl]-5-methylpyrimidin-2-one (PubChem CID 11767721) has the molecular formula C39H44N3O6PSi and a molecular weight of 709.86 g/mol. Its IUPAC name is 4-amino-1-[(2R,4S,5R)-4-[tert-butyl(diphenyl)silyl]oxy-5-(diphenylphosphoryloxymethoxymethyl)oxolan-2-yl]-5-methylpyrimidin-2-one.
| Compound Name | 4-amino-1-[(2R,4S,5R)-4-[tert-butyl(diphenyl)silyl]oxy-5-(diphenylphosphoryloxymethoxymethyl)oxolan-2-yl]-5-methylpyrimidin-2-one |
|---|---|
| PubChem CID | 11767721 |
| Molecular Formula | C39H44N3O6PSi |
| Molecular Weight | 709.86 g/mol |
| Exact Mass | 709.27 |
| IUPAC Name | 4-amino-1-[(2R,4S,5R)-4-[tert-butyl(diphenyl)silyl]oxy-5-(diphenylphosphoryloxymethoxymethyl)oxolan-2-yl]-5-methylpyrimidin-2-one |
| SMILES | Cc1cn([C@H]2C[C@H](O[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)[C@@H](COCOP(=O)(c3ccccc3)c3ccccc3)O2)c(=O)nc1N |
| InChI | InChI=1S/C39H44N3O6PSi/c1-29-26-42(38(43)41-37(29)40)36-25-34(48-50(39(2,3)4,32-21-13-7-14-22-32)33-23-15-8-16-24-33)35(47-36)27-45-28-46-49(44,30-17-9-5-10-18-30)31-19-11-6-12-20-31/h5-24,26,34-36H,25,27-28H2,1-4H3,(H2,40,41,43)/t34-,35+,36+/m0/s1 |
| InChIKey | WHPQVHZPNSMDOL-LIVOIKKVSA-N |
| XLogP | 5.29 |
| TPSA | 114.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.86 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|