C29H28IN3O3 — CID 10841185
4-amino-1-[(2R,4S,5R)-4-iodo-5-(trityloxymethyl)oxolan-2-yl]-5-methylpyrimidin-2-one (PubChem CID 10841185) has the molecular formula C29H28IN3O3 and a molecular weight of 593.47 g/mol. Its IUPAC name is 4-amino-1-[(2R,4S,5R)-4-iodo-5-(trityloxymethyl)oxolan-2-yl]-5-methylpyrimidin-2-one.
| Compound Name | 4-amino-1-[(2R,4S,5R)-4-iodo-5-(trityloxymethyl)oxolan-2-yl]-5-methylpyrimidin-2-one |
|---|---|
| PubChem CID | 10841185 |
| Molecular Formula | C29H28IN3O3 |
| Molecular Weight | 593.47 g/mol |
| Exact Mass | 593.12 |
| IUPAC Name | 4-amino-1-[(2R,4S,5R)-4-iodo-5-(trityloxymethyl)oxolan-2-yl]-5-methylpyrimidin-2-one |
| SMILES | Cc1cn([C@H]2C[C@H](I)[C@@H](COC(c3ccccc3)(c3ccccc3)c3ccccc3)O2)c(=O)nc1N |
| InChI | InChI=1S/C29H28IN3O3/c1-20-18-33(28(34)32-27(20)31)26-17-24(30)25(36-26)19-35-29(21-11-5-2-6-12-21,22-13-7-3-8-14-22)23-15-9-4-10-16-23/h2-16,18,24-26H,17,19H2,1H3,(H2,31,32,34)/t24-,25+,26+/m0/s1 |
| InChIKey | XDHQEXZQXYEATR-JIMJEQGWSA-N |
| XLogP | 5.23 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.47 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|