C30H29N3O6 — CID 10436927
2-methoxy-5-methyl-1-[(2R,4S,5S)-4-nitro-5-(trityloxymethyl)oxolan-2-yl]pyrimidin-4-one (PubChem CID 10436927) has the molecular formula C30H29N3O6 and a molecular weight of 527.58 g/mol. Its IUPAC name is 2-methoxy-5-methyl-1-[(2R,4S,5S)-4-nitro-5-(trityloxymethyl)oxolan-2-yl]pyrimidin-4-one.
| Compound Name | 2-methoxy-5-methyl-1-[(2R,4S,5S)-4-nitro-5-(trityloxymethyl)oxolan-2-yl]pyrimidin-4-one |
|---|---|
| PubChem CID | 10436927 |
| Molecular Formula | C30H29N3O6 |
| Molecular Weight | 527.58 g/mol |
| Exact Mass | 527.21 |
| IUPAC Name | 2-methoxy-5-methyl-1-[(2R,4S,5S)-4-nitro-5-(trityloxymethyl)oxolan-2-yl]pyrimidin-4-one |
| SMILES | COc1nc(=O)c(C)cn1[C@H]1C[C@H]([N+](=O)[O-])[C@@H](COC(c2ccccc2)(c2ccccc2)c2ccccc2)O1 |
| InChI | InChI=1S/C30H29N3O6/c1-21-19-32(29(37-2)31-28(21)34)27-18-25(33(35)36)26(39-27)20-38-30(22-12-6-3-7-13-22,23-14-8-4-9-15-23)24-16-10-5-11-17-24/h3-17,19,25-27H,18,20H2,1-2H3/t25-,26+,27+/m0/s1 |
| InChIKey | CVOZKLLNLSEDQN-OYUWMTPXSA-N |
| XLogP | 4.50 |
| TPSA | 105.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.58 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|