C31H28N2O5 — CID 90975307
3-[4-hydroxy-5-(trityloxymethyl)oxolan-2-yl]-6-methylfuro[2,3-d]pyrimidin-2-one (PubChem CID 90975307) has the molecular formula C31H28N2O5 and a molecular weight of 508.57 g/mol. Its IUPAC name is 3-[4-hydroxy-5-(trityloxymethyl)oxolan-2-yl]-6-methylfuro[2,3-d]pyrimidin-2-one.
| Compound Name | 3-[4-hydroxy-5-(trityloxymethyl)oxolan-2-yl]-6-methylfuro[2,3-d]pyrimidin-2-one |
|---|---|
| PubChem CID | 90975307 |
| Molecular Formula | C31H28N2O5 |
| Molecular Weight | 508.57 g/mol |
| Exact Mass | 508.20 |
| IUPAC Name | 3-[4-hydroxy-5-(trityloxymethyl)oxolan-2-yl]-6-methylfuro[2,3-d]pyrimidin-2-one |
| SMILES | Cc1cc2cn(C3CC(O)C(COC(c4ccccc4)(c4ccccc4)c4ccccc4)O3)c(=O)nc2o1 |
| InChI | InChI=1S/C31H28N2O5/c1-21-17-22-19-33(30(35)32-29(22)37-21)28-18-26(34)27(38-28)20-36-31(23-11-5-2-6-12-23,24-13-7-3-8-14-24)25-15-9-4-10-16-25/h2-17,19,26-28,34H,18,20H2,1H3 |
| InChIKey | PAKADIJIYXYKFC-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 86.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.57 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|