C37H32N2O6 — CID 102251372
3-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-[(4-tritylphenoxy)methyl]furo[2,3-d]pyrimidin-2-one (PubChem CID 102251372) has the molecular formula C37H32N2O6 and a molecular weight of 600.67 g/mol. Its IUPAC name is 3-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-[(4-tritylphenoxy)methyl]furo[2,3-d]pyrimidin-2-one.
| Compound Name | 3-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-[(4-tritylphenoxy)methyl]furo[2,3-d]pyrimidin-2-one |
|---|---|
| PubChem CID | 102251372 |
| Molecular Formula | C37H32N2O6 |
| Molecular Weight | 600.67 g/mol |
| Exact Mass | 600.23 |
| IUPAC Name | 3-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-[(4-tritylphenoxy)methyl]furo[2,3-d]pyrimidin-2-one |
| SMILES | O=c1nc2oc(COc3ccc(C(c4ccccc4)(c4ccccc4)c4ccccc4)cc3)cc2cn1[C@H]1C[C@H](O)[C@@H](CO)O1 |
| InChI | InChI=1S/C37H32N2O6/c40-23-33-32(41)21-34(45-33)39-22-25-20-31(44-35(25)38-36(39)42)24-43-30-18-16-29(17-19-30)37(26-10-4-1-5-11-26,27-12-6-2-7-13-27)28-14-8-3-9-15-28/h1-20,22,32-34,40-41H,21,23-24H2/t32-,33+,34+/m0/s1 |
| InChIKey | GOLDWUOZPAUZLZ-LBFZIJHGSA-N |
| XLogP | 5.59 |
| TPSA | 106.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.67 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|