C20H30N2O6 — CID 511678
6-(5-butoxypentyl)-3-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]furo[2,3-d]pyrimidin-2-one (PubChem CID 511678) has the molecular formula C20H30N2O6 and a molecular weight of 394.47 g/mol. Its IUPAC name is 6-(5-butoxypentyl)-3-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]furo[2,3-d]pyrimidin-2-one.
| Compound Name | 6-(5-butoxypentyl)-3-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]furo[2,3-d]pyrimidin-2-one |
|---|---|
| PubChem CID | 511678 |
| Molecular Formula | C20H30N2O6 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.21 |
| IUPAC Name | 6-(5-butoxypentyl)-3-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]furo[2,3-d]pyrimidin-2-one |
| SMILES | CCCCOCCCCCc1cc2cn([C@H]3C[C@H](O)[C@@H](CO)O3)c(=O)nc2o1 |
| InChI | InChI=1S/C20H30N2O6/c1-2-3-8-26-9-6-4-5-7-15-10-14-12-22(20(25)21-19(14)27-15)18-11-16(24)17(13-23)28-18/h10,12,16-18,23-24H,2-9,11,13H2,1H3/t16-,17+,18+/m0/s1 |
| InChIKey | DEZOOOZDEHEWDQ-RCCFBDPRSA-N |
| XLogP | 2.16 |
| TPSA | 106.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|