C27H36N2O5 — CID 5272675
6-decyl-3-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-phenylfuro[2,3-d]pyrimidin-2-one (PubChem CID 5272675) has the molecular formula C27H36N2O5 and a molecular weight of 468.59 g/mol. Its IUPAC name is 6-decyl-3-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-phenylfuro[2,3-d]pyrimidin-2-one.
| Compound Name | 6-decyl-3-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-phenylfuro[2,3-d]pyrimidin-2-one |
|---|---|
| PubChem CID | 5272675 |
| Molecular Formula | C27H36N2O5 |
| Molecular Weight | 468.59 g/mol |
| Exact Mass | 468.26 |
| IUPAC Name | 6-decyl-3-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-phenylfuro[2,3-d]pyrimidin-2-one |
| SMILES | CCCCCCCCCCc1oc2nc(=O)n([C@H]3C[C@H](O)[C@@H](CO)O3)cc2c1-c1ccccc1 |
| InChI | InChI=1S/C27H36N2O5/c1-2-3-4-5-6-7-8-12-15-22-25(19-13-10-9-11-14-19)20-17-29(27(32)28-26(20)34-22)24-16-21(31)23(18-30)33-24/h9-11,13-14,17,21,23-24,30-31H,2-8,12,15-16,18H2,1H3/t21-,23+,24+/m0/s1 |
| InChIKey | VGLAVBWKHYFWGL-QPTUXGOLSA-N |
| XLogP | 4.98 |
| TPSA | 97.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.59 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|