C22H25FN2O4 — CID 3011494
3-[(4S,5R)-4-fluoro-5-(hydroxymethyl)oxolan-2-yl]-6-(4-pentylphenyl)furo[2,3-d]pyrimidin-2-one (PubChem CID 3011494) has the molecular formula C22H25FN2O4 and a molecular weight of 400.45 g/mol. Its IUPAC name is 3-[(4S,5R)-4-fluoro-5-(hydroxymethyl)oxolan-2-yl]-6-(4-pentylphenyl)furo[2,3-d]pyrimidin-2-one.
| Compound Name | 3-[(4S,5R)-4-fluoro-5-(hydroxymethyl)oxolan-2-yl]-6-(4-pentylphenyl)furo[2,3-d]pyrimidin-2-one |
|---|---|
| PubChem CID | 3011494 |
| Molecular Formula | C22H25FN2O4 |
| Molecular Weight | 400.45 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | 3-[(4S,5R)-4-fluoro-5-(hydroxymethyl)oxolan-2-yl]-6-(4-pentylphenyl)furo[2,3-d]pyrimidin-2-one |
| SMILES | CCCCCc1ccc(-c2cc3cn(C4C[C@H](F)[C@@H](CO)O4)c(=O)nc3o2)cc1 |
| InChI | InChI=1S/C22H25FN2O4/c1-2-3-4-5-14-6-8-15(9-7-14)18-10-16-12-25(22(27)24-21(16)29-18)20-11-17(23)19(13-26)28-20/h6-10,12,17,19-20,26H,2-5,11,13H2,1H3/t17-,19+,20?/m0/s1 |
| InChIKey | JSBDRZOVIYRKIB-XRRBNZLQSA-N |
| XLogP | 4.01 |
| TPSA | 77.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.45 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|