C27H35N3O6 — CID 59525291
[(2R,5R)-2-(hydroxymethyl)-5-[2-oxo-6-(4-pentylphenyl)furo[2,3-d]pyrimidin-3-yl]oxolan-3-yl] 2-amino-3-methylbutanoate (PubChem CID 59525291) has the molecular formula C27H35N3O6 and a molecular weight of 497.59 g/mol. Its IUPAC name is [(2R,5R)-2-(hydroxymethyl)-5-[2-oxo-6-(4-pentylphenyl)furo[2,3-d]pyrimidin-3-yl]oxolan-3-yl] 2-amino-3-methylbutanoate.
| Compound Name | [(2R,5R)-2-(hydroxymethyl)-5-[2-oxo-6-(4-pentylphenyl)furo[2,3-d]pyrimidin-3-yl]oxolan-3-yl] 2-amino-3-methylbutanoate |
|---|---|
| PubChem CID | 59525291 |
| Molecular Formula | C27H35N3O6 |
| Molecular Weight | 497.59 g/mol |
| Exact Mass | 497.25 |
| IUPAC Name | [(2R,5R)-2-(hydroxymethyl)-5-[2-oxo-6-(4-pentylphenyl)furo[2,3-d]pyrimidin-3-yl]oxolan-3-yl] 2-amino-3-methylbutanoate |
| SMILES | CCCCCc1ccc(-c2cc3cn([C@H]4CC(OC(=O)C(N)C(C)C)[C@@H](CO)O4)c(=O)nc3o2)cc1 |
| InChI | InChI=1S/C27H35N3O6/c1-4-5-6-7-17-8-10-18(11-9-17)20-12-19-14-30(27(33)29-25(19)35-20)23-13-21(22(15-31)34-23)36-26(32)24(28)16(2)3/h8-12,14,16,21-24,31H,4-7,13,15,28H2,1-3H3/t21?,22-,23-,24?/m1/s1 |
| InChIKey | BLPHAJIMGKMTHA-BIELFDCTSA-N |
| XLogP | 3.56 |
| TPSA | 129.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.59 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|