C24H30N2O5 — CID 70845067
6-(4-heptoxyphenyl)-3-[(2R,4S)-4-hydroxy-5-methyloxolan-2-yl]furo[2,3-d]pyrimidin-2-one (PubChem CID 70845067) has the molecular formula C24H30N2O5 and a molecular weight of 426.51 g/mol. Its IUPAC name is 6-(4-heptoxyphenyl)-3-[(2R,4S)-4-hydroxy-5-methyloxolan-2-yl]furo[2,3-d]pyrimidin-2-one.
| Compound Name | 6-(4-heptoxyphenyl)-3-[(2R,4S)-4-hydroxy-5-methyloxolan-2-yl]furo[2,3-d]pyrimidin-2-one |
|---|---|
| PubChem CID | 70845067 |
| Molecular Formula | C24H30N2O5 |
| Molecular Weight | 426.51 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | 6-(4-heptoxyphenyl)-3-[(2R,4S)-4-hydroxy-5-methyloxolan-2-yl]furo[2,3-d]pyrimidin-2-one |
| SMILES | CCCCCCCOc1ccc(-c2cc3cn([C@H]4C[C@H](O)C(C)O4)c(=O)nc3o2)cc1 |
| InChI | InChI=1S/C24H30N2O5/c1-3-4-5-6-7-12-29-19-10-8-17(9-11-19)21-13-18-15-26(24(28)25-23(18)31-21)22-14-20(27)16(2)30-22/h8-11,13,15-16,20,22,27H,3-7,12,14H2,1-2H3/t16?,20-,22+/m0/s1 |
| InChIKey | XWYGFUXRVCIXLE-CLVUSQIQSA-N |
| XLogP | 4.67 |
| TPSA | 86.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.51 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|