C21H33N2O8P — CID 10367528
[(2R,3S,5R)-5-(6-decyl-2-oxofuro[2,3-d]pyrimidin-3-yl)-3-hydroxyoxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 10367528) has the molecular formula C21H33N2O8P and a molecular weight of 472.48 g/mol. Its IUPAC name is [(2R,3S,5R)-5-(6-decyl-2-oxofuro[2,3-d]pyrimidin-3-yl)-3-hydroxyoxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2R,3S,5R)-5-(6-decyl-2-oxofuro[2,3-d]pyrimidin-3-yl)-3-hydroxyoxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 10367528 |
| Molecular Formula | C21H33N2O8P |
| Molecular Weight | 472.48 g/mol |
| Exact Mass | 472.20 |
| IUPAC Name | [(2R,3S,5R)-5-(6-decyl-2-oxofuro[2,3-d]pyrimidin-3-yl)-3-hydroxyoxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | CCCCCCCCCCc1cc2cn([C@H]3C[C@H](O)[C@@H](COP(=O)(O)O)O3)c(=O)nc2o1 |
| InChI | InChI=1S/C21H33N2O8P/c1-2-3-4-5-6-7-8-9-10-16-11-15-13-23(21(25)22-20(15)30-16)19-12-17(24)18(31-19)14-29-32(26,27)28/h11,13,17-19,24H,2-10,12,14H2,1H3,(H2,26,27,28)/t17-,18+,19+/m0/s1 |
| InChIKey | FEOTXTFFBXFWLK-IPMKNSEASA-N |
| XLogP | 3.43 |
| TPSA | 144.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.48 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|