C25H40N2O5 — CID 513876
5-hexyl-3-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-octylfuro[2,3-d]pyrimidin-2-one (PubChem CID 513876) has the molecular formula C25H40N2O5 and a molecular weight of 448.60 g/mol. Its IUPAC name is 5-hexyl-3-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-octylfuro[2,3-d]pyrimidin-2-one.
| Compound Name | 5-hexyl-3-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-octylfuro[2,3-d]pyrimidin-2-one |
|---|---|
| PubChem CID | 513876 |
| Molecular Formula | C25H40N2O5 |
| Molecular Weight | 448.60 g/mol |
| Exact Mass | 448.29 |
| IUPAC Name | 5-hexyl-3-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-octylfuro[2,3-d]pyrimidin-2-one |
| SMILES | CCCCCCCCc1oc2nc(=O)n([C@H]3C[C@H](O)[C@@H](CO)O3)cc2c1CCCCCC |
| InChI | InChI=1S/C25H40N2O5/c1-3-5-7-9-10-12-14-21-18(13-11-8-6-4-2)19-16-27(25(30)26-24(19)32-21)23-15-20(29)22(17-28)31-23/h16,20,22-23,28-29H,3-15,17H2,1-2H3/t20-,22+,23+/m0/s1 |
| InChIKey | KPSMQTFCIYANFX-MDNUFGMLSA-N |
| XLogP | 4.66 |
| TPSA | 97.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.60 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|