C20H25ClN2O7 — CID 102407754
[(2R,3S,5R)-3-acetyloxy-5-(5-chloro-2-oxo-6-pentylfuro[2,3-d]pyrimidin-3-yl)oxolan-2-yl]methyl acetate (PubChem CID 102407754) has the molecular formula C20H25ClN2O7 and a molecular weight of 440.88 g/mol. Its IUPAC name is [(2R,3S,5R)-3-acetyloxy-5-(5-chloro-2-oxo-6-pentylfuro[2,3-d]pyrimidin-3-yl)oxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,5R)-3-acetyloxy-5-(5-chloro-2-oxo-6-pentylfuro[2,3-d]pyrimidin-3-yl)oxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 102407754 |
| Molecular Formula | C20H25ClN2O7 |
| Molecular Weight | 440.88 g/mol |
| Exact Mass | 440.14 |
| IUPAC Name | [(2R,3S,5R)-3-acetyloxy-5-(5-chloro-2-oxo-6-pentylfuro[2,3-d]pyrimidin-3-yl)oxolan-2-yl]methyl acetate |
| SMILES | CCCCCc1oc2nc(=O)n([C@H]3C[C@H](OC(C)=O)[C@@H](COC(C)=O)O3)cc2c1Cl |
| InChI | InChI=1S/C20H25ClN2O7/c1-4-5-6-7-14-18(21)13-9-23(20(26)22-19(13)30-14)17-8-15(28-12(3)25)16(29-17)10-27-11(2)24/h9,15-17H,4-8,10H2,1-3H3/t15-,16+,17+/m0/s1 |
| InChIKey | OLSMYYZISCUEHH-GVDBMIGSSA-N |
| XLogP | 3.16 |
| TPSA | 109.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.88 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|