C23H30N2O5 — CID 5272891
6-hexyl-3-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-phenyl-4,4a-dihydrofuro[2,3-d]pyrimidin-2-one (PubChem CID 5272891) has the molecular formula C23H30N2O5 and a molecular weight of 414.50 g/mol. Its IUPAC name is 6-hexyl-3-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-phenyl-4,4a-dihydrofuro[2,3-d]pyrimidin-2-one.
| Compound Name | 6-hexyl-3-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-phenyl-4,4a-dihydrofuro[2,3-d]pyrimidin-2-one |
|---|---|
| PubChem CID | 5272891 |
| Molecular Formula | C23H30N2O5 |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.22 |
| IUPAC Name | 6-hexyl-3-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-phenyl-4,4a-dihydrofuro[2,3-d]pyrimidin-2-one |
| SMILES | CCCCCCC1=C(c2ccccc2)C2CN([C@H]3C[C@H](O)[C@@H](CO)O3)C(=O)N=C2O1 |
| InChI | InChI=1S/C23H30N2O5/c1-2-3-4-8-11-18-21(15-9-6-5-7-10-15)16-13-25(23(28)24-22(16)30-18)20-12-17(27)19(14-26)29-20/h5-7,9-10,16-17,19-20,26-27H,2-4,8,11-14H2,1H3/t16?,17-,19+,20+/m0/s1 |
| InChIKey | HVSZHHZTOQMCBV-KSRCZVEISA-N |
| XLogP | 3.32 |
| TPSA | 91.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|