C9H16N3O9P — CID 174794357
6-amino-3-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-4H-pyrimidine-2,5-dione;phosphoric acid (PubChem CID 174794357) has the molecular formula C9H16N3O9P and a molecular weight of 341.21 g/mol. Its IUPAC name is 6-amino-3-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-4H-pyrimidine-2,5-dione;phosphoric acid.
| Compound Name | 6-amino-3-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-4H-pyrimidine-2,5-dione;phosphoric acid |
|---|---|
| PubChem CID | 174794357 |
| Molecular Formula | C9H16N3O9P |
| Molecular Weight | 341.21 g/mol |
| Exact Mass | 341.06 |
| IUPAC Name | 6-amino-3-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-4H-pyrimidine-2,5-dione;phosphoric acid |
| SMILES | NC1=NC(=O)N([C@H]2C[C@H](O)[C@@H](CO)O2)CC1=O.O=P(O)(O)O |
| InChI | InChI=1S/C9H13N3O5.H3O4P/c10-8-5(15)2-12(9(16)11-8)7-1-4(14)6(3-13)17-7;1-5(2,3)4/h4,6-7,13-14H,1-3H2,(H2,10,11,16);(H3,1,2,3,4)/t4-,6+,7+;/m0./s1 |
| InChIKey | JAAIBDKAMCBPGG-NQHKPBGDSA-N |
| XLogP | -3.11 |
| TPSA | 203.21 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.21 |
| LogP ≤ 5 | -3.11 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|