C26H34N2O6 — CID 5272894
5-(4-acetylphenyl)-6-heptyl-3-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-4,4a-dihydrofuro[2,3-d]pyrimidin-2-one (PubChem CID 5272894) has the molecular formula C26H34N2O6 and a molecular weight of 470.57 g/mol. Its IUPAC name is 5-(4-acetylphenyl)-6-heptyl-3-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-4,4a-dihydrofuro[2,3-d]pyrimidin-2-one.
| Compound Name | 5-(4-acetylphenyl)-6-heptyl-3-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-4,4a-dihydrofuro[2,3-d]pyrimidin-2-one |
|---|---|
| PubChem CID | 5272894 |
| Molecular Formula | C26H34N2O6 |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.24 |
| IUPAC Name | 5-(4-acetylphenyl)-6-heptyl-3-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-4,4a-dihydrofuro[2,3-d]pyrimidin-2-one |
| SMILES | CCCCCCCC1=C(c2ccc(C(C)=O)cc2)C2CN([C@H]3C[C@H](O)[C@@H](CO)O3)C(=O)N=C2O1 |
| InChI | InChI=1S/C26H34N2O6/c1-3-4-5-6-7-8-21-24(18-11-9-17(10-12-18)16(2)30)19-14-28(26(32)27-25(19)34-21)23-13-20(31)22(15-29)33-23/h9-12,19-20,22-23,29,31H,3-8,13-15H2,1-2H3/t19?,20-,22+,23+/m0/s1 |
| InChIKey | DDIPYUMTLUVVAM-CAHSUYGBSA-N |
| XLogP | 3.91 |
| TPSA | 108.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|