C16H20N2O5Se — CID 101137511
(5S)-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-methyl-5-phenylselanyl-1,3-diazinane-2,4-dione (PubChem CID 101137511) has the molecular formula C16H20N2O5Se and a molecular weight of 399.31 g/mol. Its IUPAC name is (5S)-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-methyl-5-phenylselanyl-1,3-diazinane-2,4-dione.
| Compound Name | (5S)-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-methyl-5-phenylselanyl-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 101137511 |
| Molecular Formula | C16H20N2O5Se |
| Molecular Weight | 399.31 g/mol |
| Exact Mass | 400.05 |
| IUPAC Name | (5S)-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-methyl-5-phenylselanyl-1,3-diazinane-2,4-dione |
| SMILES | C[C@]1([Se]c2ccccc2)CN([C@H]2C[C@H](O)[C@@H](CO)O2)C(=O)NC1=O |
| InChI | InChI=1S/C16H20N2O5Se/c1-16(24-10-5-3-2-4-6-10)9-18(15(22)17-14(16)21)13-7-11(20)12(8-19)23-13/h2-6,11-13,19-20H,7-9H2,1H3,(H,17,21,22)/t11-,12+,13+,16-/m0/s1 |
| InChIKey | AVOZSXYNXXCHRU-VLXAULBPSA-N |
| XLogP | -0.79 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.31 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|