C9H13BrN2O5 — CID 72513072
5-bromo-1-[4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,3-diazinane-2,4-dione (PubChem CID 72513072) has the molecular formula C9H13BrN2O5 and a molecular weight of 309.12 g/mol. Its IUPAC name is 5-bromo-1-[4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,3-diazinane-2,4-dione.
| Compound Name | 5-bromo-1-[4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 72513072 |
| Molecular Formula | C9H13BrN2O5 |
| Molecular Weight | 309.12 g/mol |
| Exact Mass | 308.00 |
| IUPAC Name | 5-bromo-1-[4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,3-diazinane-2,4-dione |
| SMILES | O=C1NC(=O)N(C2CC(O)C(CO)O2)CC1Br |
| InChI | InChI=1S/C9H13BrN2O5/c10-4-2-12(9(16)11-8(4)15)7-1-5(14)6(3-13)17-7/h4-7,13-14H,1-3H2,(H,11,15,16) |
| InChIKey | ZXKQNGRKQAUEJT-UHFFFAOYSA-N |
| XLogP | -1.23 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.12 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|