C10H17N2NaO8P — CID 156592060
CID 156592060 (PubChem CID 156592060) has the molecular formula C10H17N2NaO8P and a molecular weight of 347.22 g/mol.
| Compound Name | CID 156592060 |
|---|---|
| PubChem CID | 156592060 |
| Molecular Formula | C10H17N2NaO8P |
| Molecular Weight | 347.22 g/mol |
| Exact Mass | 347.06 |
| IUPAC Name | — |
| SMILES | CC1CN([C@H]2C[C@H](O)[C@@H](COP(=O)(O)O)O2)C(=O)NC1=O.[Na] |
| InChI | InChI=1S/C10H17N2O8P.Na/c1-5-3-12(10(15)11-9(5)14)8-2-6(13)7(20-8)4-19-21(16,17)18;/h5-8,13H,2-4H2,1H3,(H,11,14,15)(H2,16,17,18);/t5?,6-,7+,8+;/m0./s1 |
| InChIKey | OUNZAUODDWJICN-TVEPBQBDSA-N |
| XLogP | -1.62 |
| TPSA | 145.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.22 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|