C9H13N4O8P — CID 18608218
[(2R,3S,5R)-5-(5-diazo-2,4-dioxo-1,3-diazinan-1-yl)-3-hydroxyoxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 18608218) has the molecular formula C9H13N4O8P and a molecular weight of 336.20 g/mol. Its IUPAC name is [(2R,3S,5R)-5-(5-diazo-2,4-dioxo-1,3-diazinan-1-yl)-3-hydroxyoxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2R,3S,5R)-5-(5-diazo-2,4-dioxo-1,3-diazinan-1-yl)-3-hydroxyoxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 18608218 |
| Molecular Formula | C9H13N4O8P |
| Molecular Weight | 336.20 g/mol |
| Exact Mass | 336.05 |
| IUPAC Name | [(2R,3S,5R)-5-(5-diazo-2,4-dioxo-1,3-diazinan-1-yl)-3-hydroxyoxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | [N-]=[N+]=C1CN([C@H]2C[C@H](O)[C@@H](COP(=O)(O)O)O2)C(=O)NC1=O |
| InChI | InChI=1S/C9H13N4O8P/c10-12-4-2-13(9(16)11-8(4)15)7-1-5(14)6(21-7)3-20-22(17,18)19/h5-7,14H,1-3H2,(H,11,15,16)(H2,17,18,19)/t5-,6+,7+/m0/s1 |
| InChIKey | MKRNFBGEHFTUQK-RRKCRQDMSA-N |
| XLogP | -2.21 |
| TPSA | 182.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.20 |
| LogP ≤ 5 | -2.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|